C28H33N7O3S — CID 131910962
(7S)-7-benzyl-1'-(2-pyridin-2-ylsulfanylacetyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131910962) has the molecular formula C28H33N7O3S and a molecular weight of 547.69 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-(2-pyridin-2-ylsulfanylacetyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-(2-pyridin-2-ylsulfanylacetyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131910962 |
| Molecular Formula | C28H33N7O3S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | (7S)-7-benzyl-1'-(2-pyridin-2-ylsulfanylacetyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | O=C1NCCCn2cc(nn2)CC2(CCN(C(=O)CSc3ccccn3)CC2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H33N7O3S/c36-25(20-39-24-9-4-5-12-29-24)34-15-10-28(11-16-34)18-22-19-35(33-32-22)14-6-13-30-26(37)23(31-27(28)38)17-21-7-2-1-3-8-21/h1-5,7-9,12,19,23H,6,10-11,13-18,20H2,(H,30,37)(H,31,38)/t23-/m0/s1 |
| InChIKey | ITEDEOMHTISWMO-QHCPKHFHSA-N |
| XLogP | 1.86 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |