C28H37N7O3 — CID 131907315
(7S)-7-benzyl-1'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131907315) has the molecular formula C28H37N7O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131907315 |
| Molecular Formula | C28H37N7O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (7S)-7-benzyl-1'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | CC(C)c1cc(CN2CCC3(CC2)Cc2cn(nn2)CCCNC(=O)[C@H](Cc2ccccc2)NC3=O)on1 |
| InChI | InChI=1S/C28H37N7O3/c1-20(2)24-16-23(38-32-24)19-34-13-9-28(10-14-34)17-22-18-35(33-31-22)12-6-11-29-26(36)25(30-27(28)37)15-21-7-4-3-5-8-21/h3-5,7-8,16,18,20,25H,6,9-15,17,19H2,1-2H3,(H,29,36)(H,30,37)/t25-/m0/s1 |
| InChIKey | HRJYHFWBRAGFIY-VWLOTQADSA-N |
| XLogP | 2.46 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |