C21H36N2O3 — CID 131911363
2-(3-hydroxy-1-adamantyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide (PubChem CID 131911363) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-(3-hydroxy-1-adamantyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | 2-(3-hydroxy-1-adamantyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 131911363 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 2-(3-hydroxy-1-adamantyl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide |
| SMILES | COCCN1CCCC(CNC(=O)CC23CC4CC(CC(O)(C4)C2)C3)C1 |
| InChI | InChI=1S/C21H36N2O3/c1-26-6-5-23-4-2-3-16(14-23)13-22-19(24)12-20-8-17-7-18(9-20)11-21(25,10-17)15-20/h16-18,25H,2-15H2,1H3,(H,22,24) |
| InChIKey | UOHXUFSRIAPUNX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |