C19H38N4O6 — CID 154907400
2-(4-ethylpiperazin-1-yl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide;formic acid (PubChem CID 154907400) has the molecular formula C19H38N4O6 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide;formic acid.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 154907400 |
| Molecular Formula | C19H38N4O6 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-[[1-(2-methoxyethyl)piperidin-3-yl]methyl]acetamide;formic acid |
| SMILES | CCN1CCN(CC(=O)NCC2CCCN(CCOC)C2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C17H34N4O2.2CH2O2/c1-3-19-7-9-21(10-8-19)15-17(22)18-13-16-5-4-6-20(14-16)11-12-23-2;2*2-1-3/h16H,3-15H2,1-2H3,(H,18,22);2*1H,(H,2,3) |
| InChIKey | APDHYAZXHLQOLO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|