C20H24N2O3S — CID 131913002
(E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[1-[(3-hydroxyphenyl)methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 131913002) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[1-[(3-hydroxyphenyl)methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[1-[(3-hydroxyphenyl)methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 131913002 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[1-[(3-hydroxyphenyl)methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(CO)cs1)NC1CCN(Cc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C20H24N2O3S/c23-13-16-11-19(26-14-16)4-5-20(25)21-17-6-8-22(9-7-17)12-15-2-1-3-18(24)10-15/h1-5,10-11,14,17,23-24H,6-9,12-13H2,(H,21,25)/b5-4+ |
| InChIKey | ROOKCGSXYOPKFO-SNAWJCMRSA-N |
| XLogP | 2.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|