C19H22N2O4S2 — CID 171139963
N-[1-(benzenesulfonyl)piperidin-4-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-enamide (PubChem CID 171139963) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)piperidin-4-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | N-[1-(benzenesulfonyl)piperidin-4-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171139963 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[1-(benzenesulfonyl)piperidin-4-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(CO)cs1)NC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O4S2/c22-13-15-12-17(26-14-15)6-7-19(23)20-16-8-10-21(11-9-16)27(24,25)18-4-2-1-3-5-18/h1-7,12,14,16,22H,8-11,13H2,(H,20,23) |
| InChIKey | JLVYYYFHCHQGAE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|