C25H31N3O4S — CID 24614354
(E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 24614354) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24614354 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC(NC(=O)/C=C/c3ccc(C(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-18(2)21-7-4-20(5-8-21)6-13-25(30)27-23-14-16-28(17-15-23)33(31,32)24-11-9-22(10-12-24)26-19(3)29/h4-13,18,23H,14-17H2,1-3H3,(H,26,29)(H,27,30)/b13-6+ |
| InChIKey | TWGGUAQRODYCKS-AWNIVKPZSA-N |
| XLogP | 3.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|