C24H27N3O5S — CID 24614409
(E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide (PubChem CID 24614409) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24614409 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC(NC(=O)/C=C/c3ccc4c(c3)CCO4)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-17(28)25-20-4-6-22(7-5-20)33(30,31)27-13-10-21(11-14-27)26-24(29)9-3-18-2-8-23-19(16-18)12-15-32-23/h2-9,16,21H,10-15H2,1H3,(H,25,28)(H,26,29)/b9-3+ |
| InChIKey | QZWIIRMTYYZJGZ-YCRREMRBSA-N |
| XLogP | 2.56 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|