C22H23Cl2N3O4S — CID 24614351
(E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 24614351) has the molecular formula C22H23Cl2N3O4S and a molecular weight of 496.42 g/mol. Its IUPAC name is (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24614351 |
| Molecular Formula | C22H23Cl2N3O4S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (E)-N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-3-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC(NC(=O)/C=C/c3cccc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O4S/c1-15(28)25-17-6-8-19(9-7-17)32(30,31)27-13-11-18(12-14-27)26-21(29)10-5-16-3-2-4-20(23)22(16)24/h2-10,18H,11-14H2,1H3,(H,25,28)(H,26,29)/b10-5+ |
| InChIKey | DXDRRRLLFFMVFN-BJMVGYQFSA-N |
| XLogP | 3.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|