C23H27N3O5S — CID 89236196
benzyl-[3-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylphenyl]carbamic acid (PubChem CID 89236196) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is benzyl-[3-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylphenyl]carbamic acid.
| Compound Name | benzyl-[3-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylphenyl]carbamic acid |
|---|---|
| PubChem CID | 89236196 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | benzyl-[3-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylphenyl]carbamic acid |
| SMILES | C=CC(=O)NC1CCCN(S(=O)(=O)c2cccc(N(Cc3ccccc3)C(=O)O)c2)CC1 |
| InChI | InChI=1S/C23H27N3O5S/c1-2-22(27)24-19-10-7-14-25(15-13-19)32(30,31)21-12-6-11-20(16-21)26(23(28)29)17-18-8-4-3-5-9-18/h2-6,8-9,11-12,16,19H,1,7,10,13-15,17H2,(H,24,27)(H,28,29) |
| InChIKey | YQSZLJOSKKIPLW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|