C24H26N4O3S — CID 89238217
N-[1-[4-(isoquinolin-3-ylamino)phenyl]sulfonylazepan-4-yl]prop-2-enamide (PubChem CID 89238217) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[1-[4-(isoquinolin-3-ylamino)phenyl]sulfonylazepan-4-yl]prop-2-enamide.
| Compound Name | N-[1-[4-(isoquinolin-3-ylamino)phenyl]sulfonylazepan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238217 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[1-[4-(isoquinolin-3-ylamino)phenyl]sulfonylazepan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCN(S(=O)(=O)c2ccc(Nc3cc4ccccc4cn3)cc2)CC1 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-24(29)27-20-8-5-14-28(15-13-20)32(30,31)22-11-9-21(10-12-22)26-23-16-18-6-3-4-7-19(18)17-25-23/h2-4,6-7,9-12,16-17,20H,1,5,8,13-15H2,(H,25,26)(H,27,29) |
| InChIKey | QYCXCMYLPDDPNT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|