C23H25N3O6S — CID 89236997
benzyl-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]carbamic acid (PubChem CID 89236997) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is benzyl-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]carbamic acid.
| Compound Name | benzyl-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 89236997 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | benzyl-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]carbamic acid |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(N(Cc4ccccc4)C(=O)O)cc3)CC2O1 |
| InChI | InChI=1S/C23H25N3O6S/c1-2-21(27)24-22-12-17-14-25(15-20(17)32-22)33(30,31)19-10-8-18(9-11-19)26(23(28)29)13-16-6-4-3-5-7-16/h2-11,17,20,22H,1,12-15H2,(H,24,27)(H,28,29) |
| InChIKey | LOLVTQNKGHRVKT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|