C17H23ClN6O — CID 131913211
N-[5-chloro-2-(3-methylpiperidin-1-yl)phenyl]-3-(5-methyltetrazol-1-yl)propanamide (PubChem CID 131913211) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is N-[5-chloro-2-(3-methylpiperidin-1-yl)phenyl]-3-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[5-chloro-2-(3-methylpiperidin-1-yl)phenyl]-3-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 131913211 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[5-chloro-2-(3-methylpiperidin-1-yl)phenyl]-3-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1CCC(=O)Nc1cc(Cl)ccc1N1CCCC(C)C1 |
| InChI | InChI=1S/C17H23ClN6O/c1-12-4-3-8-23(11-12)16-6-5-14(18)10-15(16)19-17(25)7-9-24-13(2)20-21-22-24/h5-6,10,12H,3-4,7-9,11H2,1-2H3,(H,19,25) |
| InChIKey | RMDAIXFEVJAZKO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |