C18H15FN4O — CID 131913904
3-(3-cyanophenyl)-1-[(5-fluoro-1H-indol-2-yl)methyl]-1-methylurea (PubChem CID 131913904) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-1-[(5-fluoro-1H-indol-2-yl)methyl]-1-methylurea.
| Compound Name | 3-(3-cyanophenyl)-1-[(5-fluoro-1H-indol-2-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 131913904 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-(3-cyanophenyl)-1-[(5-fluoro-1H-indol-2-yl)methyl]-1-methylurea |
| SMILES | CN(Cc1cc2cc(F)ccc2[nH]1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H15FN4O/c1-23(18(24)22-15-4-2-3-12(7-15)10-20)11-16-9-13-8-14(19)5-6-17(13)21-16/h2-9,21H,11H2,1H3,(H,22,24) |
| InChIKey | UTWWEAMNQSWGLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |