C18H18BN3O — CID 89133136
CID 89133136 (PubChem CID 89133136) has the molecular formula C18H18BN3O and a molecular weight of 303.17 g/mol.
| Compound Name | CID 89133136 |
|---|---|
| PubChem CID | 89133136 |
| Molecular Formula | C18H18BN3O |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCCN(C)C(=O)Nc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C18H18BN3O/c1-22(11-3-5-14-7-9-16(19)10-8-14)18(23)21-17-6-2-4-15(12-17)13-20/h2,4,6-10,12H,3,5,11H2,1H3,(H,21,23) |
| InChIKey | JZPUQLNEDSUODM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|