C19H20BN3O — CID 89133180
CID 89133180 (PubChem CID 89133180) has the molecular formula C19H20BN3O and a molecular weight of 317.20 g/mol.
| Compound Name | CID 89133180 |
|---|---|
| PubChem CID | 89133180 |
| Molecular Formula | C19H20BN3O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCN(C)C(=O)Nc2cccc(C#N)c2)c(CC)c1 |
| InChI | InChI=1S/C19H20BN3O/c1-3-15-12-17(20)8-7-16(15)9-10-23(2)19(24)22-18-6-4-5-14(11-18)13-21/h4-8,11-12H,3,9-10H2,1-2H3,(H,22,24) |
| InChIKey | SSQMQXUGQTUBLS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|