C16H21N3O4S — CID 131914293
N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-(4-methylphenyl)methanesulfonamide (PubChem CID 131914293) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-(4-methylphenyl)methanesulfonamide.
| Compound Name | N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 131914293 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-(4-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(CS(=O)(=O)N[C@@H]2C[C@H]3C(=O)N(C)CC(=O)N3C2)cc1 |
| InChI | InChI=1S/C16H21N3O4S/c1-11-3-5-12(6-4-11)10-24(22,23)17-13-7-14-16(21)18(2)9-15(20)19(14)8-13/h3-6,13-14,17H,7-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | DYGUVMDAHJHHEI-KGLIPLIRSA-N |
| XLogP | -0.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |