C17H26FNO3 — CID 131915575
1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-6,6-dimethylazepan-4-ol (PubChem CID 131915575) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-6,6-dimethylazepan-4-ol.
| Compound Name | 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-6,6-dimethylazepan-4-ol |
|---|---|
| PubChem CID | 131915575 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-6,6-dimethylazepan-4-ol |
| SMILES | COc1cc(F)c(CN2CCC(O)CC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C17H26FNO3/c1-17(2)9-13(20)5-6-19(11-17)10-12-7-15(21-3)16(22-4)8-14(12)18/h7-8,13,20H,5-6,9-11H2,1-4H3 |
| InChIKey | XKUJGDSUYBTQRV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |