C19H25FN2O2 — CID 131915595
2-(3-fluorophenoxy)-N-[(1-pent-2-ynylpiperidin-3-yl)methyl]acetamide (PubChem CID 131915595) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N-[(1-pent-2-ynylpiperidin-3-yl)methyl]acetamide.
| Compound Name | 2-(3-fluorophenoxy)-N-[(1-pent-2-ynylpiperidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 131915595 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-(3-fluorophenoxy)-N-[(1-pent-2-ynylpiperidin-3-yl)methyl]acetamide |
| SMILES | CCC#CCN1CCCC(CNC(=O)COc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H25FN2O2/c1-2-3-4-10-22-11-6-7-16(14-22)13-21-19(23)15-24-18-9-5-8-17(20)12-18/h5,8-9,12,16H,2,6-7,10-11,13-15H2,1H3,(H,21,23) |
| InChIKey | NUCWCVUNCVAMJC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|