C19H23FN2O2S — CID 124756360
2-[(3R)-3-[(3-fluorophenoxy)methyl]piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 124756360) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[(3R)-3-[(3-fluorophenoxy)methyl]piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(3R)-3-[(3-fluorophenoxy)methyl]piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 124756360 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[(3R)-3-[(3-fluorophenoxy)methyl]piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCC[C@@H](COc2cccc(F)c2)C1)NCc1cccs1 |
| InChI | InChI=1S/C19H23FN2O2S/c20-16-5-1-6-17(10-16)24-14-15-4-2-8-22(12-15)13-19(23)21-11-18-7-3-9-25-18/h1,3,5-7,9-10,15H,2,4,8,11-14H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | SLWOGKZZSPIOLH-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |