C17H23FN4O3 — CID 154909978
3-[(3-fluorophenoxy)methyl]-1-[2-(1,2,4-triazol-4-yl)ethyl]piperidine;formic acid (PubChem CID 154909978) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-[(3-fluorophenoxy)methyl]-1-[2-(1,2,4-triazol-4-yl)ethyl]piperidine;formic acid.
| Compound Name | 3-[(3-fluorophenoxy)methyl]-1-[2-(1,2,4-triazol-4-yl)ethyl]piperidine;formic acid |
|---|---|
| PubChem CID | 154909978 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-[(3-fluorophenoxy)methyl]-1-[2-(1,2,4-triazol-4-yl)ethyl]piperidine;formic acid |
| SMILES | Fc1cccc(OCC2CCCN(CCn3cnnc3)C2)c1.O=CO |
| InChI | InChI=1S/C16H21FN4O.CH2O2/c17-15-4-1-5-16(9-15)22-11-14-3-2-6-20(10-14)7-8-21-12-18-19-13-21;2-1-3/h1,4-5,9,12-14H,2-3,6-8,10-11H2;1H,(H,2,3) |
| InChIKey | SRONWUPDTYPZQX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|