C19H28ClN3O2 — CID 131915716
2-chloro-4-[2-[cyclohexyl(methyl)amino]propanoylamino]-N-ethylbenzamide (PubChem CID 131915716) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 2-chloro-4-[2-[cyclohexyl(methyl)amino]propanoylamino]-N-ethylbenzamide.
| Compound Name | 2-chloro-4-[2-[cyclohexyl(methyl)amino]propanoylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 131915716 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-chloro-4-[2-[cyclohexyl(methyl)amino]propanoylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)C(C)N(C)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C19H28ClN3O2/c1-4-21-19(25)16-11-10-14(12-17(16)20)22-18(24)13(2)23(3)15-8-6-5-7-9-15/h10-13,15H,4-9H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | WXCLPOGVRRNSHH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |