C35H40N6O6 — CID 131920021
(6R,12R,15S,18S)-6-benzyl-15-methyl-4,7,13,16-tetraoxo-N-(2-pyridin-3-ylethyl)-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide (PubChem CID 131920021) has the molecular formula C35H40N6O6 and a molecular weight of 640.74 g/mol. Its IUPAC name is (6R,12R,15S,18S)-6-benzyl-15-methyl-4,7,13,16-tetraoxo-N-(2-pyridin-3-ylethyl)-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide.
| Compound Name | (6R,12R,15S,18S)-6-benzyl-15-methyl-4,7,13,16-tetraoxo-N-(2-pyridin-3-ylethyl)-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide |
|---|---|
| PubChem CID | 131920021 |
| Molecular Formula | C35H40N6O6 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | (6R,12R,15S,18S)-6-benzyl-15-methyl-4,7,13,16-tetraoxo-N-(2-pyridin-3-ylethyl)-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide |
| SMILES | C[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NC(=O)COc2ccc(cc2)C[C@@H](C(=O)NCCc2cccnc2)NC1=O |
| InChI | InChI=1S/C35H40N6O6/c1-23-32(43)40-28(33(44)37-17-15-26-9-5-16-36-21-26)19-25-11-13-27(14-12-25)47-22-31(42)39-29(20-24-7-3-2-4-8-24)35(46)41-18-6-10-30(41)34(45)38-23/h2-5,7-9,11-14,16,21,23,28-30H,6,10,15,17-20,22H2,1H3,(H,37,44)(H,38,45)(H,39,42)(H,40,43)/t23-,28-,29+,30+/m0/s1 |
| InChIKey | TYUDJSQGKVAVMU-IUFAUYNMSA-N |
| XLogP | 1.08 |
| TPSA | 158.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |