C32H41N5O6S — CID 131932545
(6R,12R,15S,18R)-6-benzyl-15-methyl-N-(3-methylsulfanylpropyl)-4,7,13,16-tetraoxo-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide (PubChem CID 131932545) has the molecular formula C32H41N5O6S and a molecular weight of 623.78 g/mol. Its IUPAC name is (6R,12R,15S,18R)-6-benzyl-15-methyl-N-(3-methylsulfanylpropyl)-4,7,13,16-tetraoxo-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide.
| Compound Name | (6R,12R,15S,18R)-6-benzyl-15-methyl-N-(3-methylsulfanylpropyl)-4,7,13,16-tetraoxo-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide |
|---|---|
| PubChem CID | 131932545 |
| Molecular Formula | C32H41N5O6S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | (6R,12R,15S,18R)-6-benzyl-15-methyl-N-(3-methylsulfanylpropyl)-4,7,13,16-tetraoxo-2-oxa-5,8,14,17-tetrazatricyclo[18.2.2.08,12]tetracosa-1(23),20(24),21-triene-18-carboxamide |
| SMILES | CSCCCNC(=O)[C@H]1Cc2ccc(cc2)OCC(=O)N[C@H](Cc2ccccc2)C(=O)N2CCC[C@@H]2C(=O)N[C@@H](C)C(=O)N1 |
| InChI | InChI=1S/C32H41N5O6S/c1-21-29(39)36-25(30(40)33-15-7-17-44-2)18-23-11-13-24(14-12-23)43-20-28(38)35-26(19-22-8-4-3-5-9-22)32(42)37-16-6-10-27(37)31(41)34-21/h3-5,8-9,11-14,21,25-27H,6-7,10,15-20H2,1-2H3,(H,33,40)(H,34,41)(H,35,38)(H,36,39)/t21-,25+,26+,27+/m0/s1 |
| InChIKey | SNLRVLZELLREKG-IZIBRLFBSA-N |
| XLogP | 1.20 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|