C39H38N4O7S — CID 90770725
5,11,14,17-tetraoxo-12-[(4-phenylphenyl)methyl]-15-(1-thiophen-2-ylethenyl)-19-oxa-4,10,13,16-tetrazatricyclo[18.2.2.06,10]tetracosa-1(23),20(24),21-triene-3-carboxylic acid (PubChem CID 90770725) has the molecular formula C39H38N4O7S and a molecular weight of 706.82 g/mol. Its IUPAC name is 5,11,14,17-tetraoxo-12-[(4-phenylphenyl)methyl]-15-(1-thiophen-2-ylethenyl)-19-oxa-4,10,13,16-tetrazatricyclo[18.2.2.06,10]tetracosa-1(23),20(24),21-triene-3-carboxylic acid.
| Compound Name | 5,11,14,17-tetraoxo-12-[(4-phenylphenyl)methyl]-15-(1-thiophen-2-ylethenyl)-19-oxa-4,10,13,16-tetrazatricyclo[18.2.2.06,10]tetracosa-1(23),20(24),21-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 90770725 |
| Molecular Formula | C39H38N4O7S |
| Molecular Weight | 706.82 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | 5,11,14,17-tetraoxo-12-[(4-phenylphenyl)methyl]-15-(1-thiophen-2-ylethenyl)-19-oxa-4,10,13,16-tetrazatricyclo[18.2.2.06,10]tetracosa-1(23),20(24),21-triene-3-carboxylic acid |
| SMILES | C=C(c1cccs1)C1NC(=O)COc2ccc(cc2)CC(C(=O)O)NC(=O)C2CCCN2C(=O)C(Cc2ccc(-c3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C39H38N4O7S/c1-24(33-10-6-20-51-33)35-37(46)40-30(21-25-11-15-28(16-12-25)27-7-3-2-4-8-27)38(47)43-19-5-9-32(43)36(45)41-31(39(48)49)22-26-13-17-29(18-14-26)50-23-34(44)42-35/h2-4,6-8,10-18,20,30-32,35H,1,5,9,19,21-23H2,(H,40,46)(H,41,45)(H,42,44)(H,48,49) |
| InChIKey | DJAHXQSWHNPSGN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|