C41H39N3O7S2 — CID 162021386
(6R,9S,12R,15R)-4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11-triazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid (PubChem CID 162021386) has the molecular formula C41H39N3O7S2 and a molecular weight of 749.91 g/mol. Its IUPAC name is (6R,9S,12R,15R)-4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11-triazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid.
| Compound Name | (6R,9S,12R,15R)-4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11-triazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
|---|---|
| PubChem CID | 162021386 |
| Molecular Formula | C41H39N3O7S2 |
| Molecular Weight | 749.91 g/mol |
| Exact Mass | 749.22 |
| IUPAC Name | (6R,9S,12R,15R)-4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11-triazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
| SMILES | O=C1COc2ccc(cc2)C[C@@H](C(=O)O)CC(=O)[C@@H](Cc2cccs2)NC(=O)[C@H](Cc2ccc(-c3ccccc3)cc2)NC(=O)[C@@H](Cc2cccs2)N1 |
| InChI | InChI=1S/C41H39N3O7S2/c45-37-22-30(41(49)50)20-26-12-16-31(17-13-26)51-25-38(46)42-36(24-33-9-5-19-53-33)40(48)44-35(39(47)43-34(37)23-32-8-4-18-52-32)21-27-10-14-29(15-11-27)28-6-2-1-3-7-28/h1-19,30,34-36H,20-25H2,(H,42,46)(H,43,47)(H,44,48)(H,49,50)/t30-,34-,35+,36-/m1/s1 |
| InChIKey | YUUHTAWUIHNFAK-XXSYETNWSA-N |
| XLogP | 5.25 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|