C40H38N4O7S2 — CID 78032557
4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid (PubChem CID 78032557) has the molecular formula C40H38N4O7S2 and a molecular weight of 750.90 g/mol. Its IUPAC name is 4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid.
| Compound Name | 4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
|---|---|
| PubChem CID | 78032557 |
| Molecular Formula | C40H38N4O7S2 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.22 |
| IUPAC Name | 4,7,10,13-tetraoxo-9-[(4-phenylphenyl)methyl]-6,12-bis(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
| SMILES | O=C1COc2ccc(cc2)CC(C(=O)O)NC(=O)C(Cc2cccs2)NC(=O)C(Cc2ccc(-c3ccccc3)cc2)NC(=O)C(Cc2cccs2)N1 |
| InChI | InChI=1S/C40H38N4O7S2/c45-36-24-51-29-16-12-26(13-17-29)21-35(40(49)50)44-39(48)34(23-31-9-5-19-53-31)43-37(46)32(42-38(47)33(41-36)22-30-8-4-18-52-30)20-25-10-14-28(15-11-25)27-6-2-1-3-7-27/h1-19,32-35H,20-24H2,(H,41,45)(H,42,47)(H,43,46)(H,44,48)(H,49,50) |
| InChIKey | CKYDKDCGLVRTPH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|