C49H46N4O7S — CID 90857703
4,7,10,13-tetraoxo-9,12-bis[(4-phenylphenyl)methyl]-6-(1-thiophen-2-ylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid (PubChem CID 90857703) has the molecular formula C49H46N4O7S and a molecular weight of 835.00 g/mol. Its IUPAC name is 4,7,10,13-tetraoxo-9,12-bis[(4-phenylphenyl)methyl]-6-(1-thiophen-2-ylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid.
| Compound Name | 4,7,10,13-tetraoxo-9,12-bis[(4-phenylphenyl)methyl]-6-(1-thiophen-2-ylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
|---|---|
| PubChem CID | 90857703 |
| Molecular Formula | C49H46N4O7S |
| Molecular Weight | 835.00 g/mol |
| Exact Mass | 834.31 |
| IUPAC Name | 4,7,10,13-tetraoxo-9,12-bis[(4-phenylphenyl)methyl]-6-(1-thiophen-2-ylethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
| SMILES | CC(c1cccs1)C1NC(=O)COc2ccc(cc2)CC(C(=O)O)NC(=O)C(Cc2ccc(-c3ccccc3)cc2)NC(=O)C(Cc2ccc(-c3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C49H46N4O7S/c1-31(43-13-8-26-61-43)45-48(57)51-41(28-33-16-22-38(23-17-33)36-11-6-3-7-12-36)46(55)50-40(27-32-14-20-37(21-15-32)35-9-4-2-5-10-35)47(56)52-42(49(58)59)29-34-18-24-39(25-19-34)60-30-44(54)53-45/h2-26,31,40-42,45H,27-30H2,1H3,(H,50,55)(H,51,57)(H,52,56)(H,53,54)(H,58,59) |
| InChIKey | HKYGDFSSVKLHIU-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.00 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|