C15H23N5O — CID 131921776
(2R)-2-amino-2-[2-(6-methyl-2-pyridinyl)-5-pentyl-1,2,4-triazol-3-yl]ethanol (PubChem CID 131921776) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-(6-methyl-2-pyridinyl)-5-pentyl-1,2,4-triazol-3-yl]ethanol.
| Compound Name | (2R)-2-amino-2-[2-(6-methyl-2-pyridinyl)-5-pentyl-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 131921776 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (2R)-2-amino-2-[2-(6-methyl-2-pyridinyl)-5-pentyl-1,2,4-triazol-3-yl]ethanol |
| SMILES | CCCCCc1nc([C@@H](N)CO)n(-c2cccc(C)n2)n1 |
| InChI | InChI=1S/C15H23N5O/c1-3-4-5-8-13-18-15(12(16)10-21)20(19-13)14-9-6-7-11(2)17-14/h6-7,9,12,21H,3-5,8,10,16H2,1-2H3/t12-/m0/s1 |
| InChIKey | RQJJATONCOGIJY-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|