About N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 131924189) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide |
| PubChem CID | 131924189 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@@H]1CC=CC[C@H]1C(N)=O |
| InChI | InChI=1S/C13H17N3O2/c1-16-8-4-7-11(16)13(18)15-10-6-3-2-5-9(10)12(14)17/h2-4,7-10H,5-6H2,1H3,(H2,14,17)(H,15,18)/t9-,10-/m1/s1 |
| InChIKey | VXFJNZYDZLBHAM-NXEZZACHSA-N |
| XLogP | 0.57 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide?
The IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide (CID 131924189) is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide?
The canonical SMILES for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide is Cn1cccc1C(=O)N[C@@H]1CC=CC[C@H]1C(N)=O.
What is the InChIKey of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide?
The InChIKey is VXFJNZYDZLBHAM-NXEZZACHSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-16-8-4-7-11(16)13(18)15-10-6-3-2-5-9(10)12(14)17/h2-4,7-10H,5-6H2,1H3,(H2,14,17)(H,15,18)/t9-,10-/m1/s1.
What are the key properties of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide?
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide has a molecular weight of 247.30 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 131924189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).