C13H17N3O2 — CID 131924189
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 131924189) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 131924189 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)N[C@@H]1CC=CC[C@H]1C(N)=O |
| InChI | InChI=1S/C13H17N3O2/c1-16-8-4-7-11(16)13(18)15-10-6-3-2-5-9(10)12(14)17/h2-4,7-10H,5-6H2,1H3,(H2,14,17)(H,15,18)/t9-,10-/m1/s1 |
| InChIKey | VXFJNZYDZLBHAM-NXEZZACHSA-N |
| XLogP | 0.57 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|