C21H24N6O — CID 131924497
2-[4-(5-methyltetrazol-1-yl)phenyl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide (PubChem CID 131924497) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[4-(5-methyltetrazol-1-yl)phenyl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[4-(5-methyltetrazol-1-yl)phenyl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 131924497 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[4-(5-methyltetrazol-1-yl)phenyl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide |
| SMILES | Cc1nnnn1-c1ccc(CC(=O)Nc2ccccc2CN2CCCC2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-16-23-24-25-27(16)19-10-8-17(9-11-19)14-21(28)22-20-7-3-2-6-18(20)15-26-12-4-5-13-26/h2-3,6-11H,4-5,12-15H2,1H3,(H,22,28) |
| InChIKey | DWIICTKKHUJHBC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |