C14H16N4O2S — CID 131926417
7-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 131926417) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 7-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 131926417 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 7-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | Cc1sc2ncnc(N3CCN4C(=O)OCC4C3)c2c1C |
| InChI | InChI=1S/C14H16N4O2S/c1-8-9(2)21-13-11(8)12(15-7-16-13)17-3-4-18-10(5-17)6-20-14(18)19/h7,10H,3-6H2,1-2H3 |
| InChIKey | ZZJPFEUVEXRYPV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |