C21H29NO2 — CID 131926420
N-(cyclohexylmethyl)-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide (PubChem CID 131926420) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide.
| Compound Name | N-(cyclohexylmethyl)-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 131926420 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-(cyclohexylmethyl)-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
| SMILES | CCN(CC1CCCCC1)C(=O)c1ccc(C#CC(C)(C)O)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-22(16-18-8-6-5-7-9-18)20(23)19-12-10-17(11-13-19)14-15-21(2,3)24/h10-13,18,24H,4-9,16H2,1-3H3 |
| InChIKey | VXHMGWSPGMRTOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|