C21H28N2O2 — CID 90550004
4-[3-(3-cyclohexylpropanoylamino)prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90550004) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[3-(3-cyclohexylpropanoylamino)prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(3-cyclohexylpropanoylamino)prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90550004 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-[3-(3-cyclohexylpropanoylamino)prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-23(2)21(25)19-13-10-18(11-14-19)9-6-16-22-20(24)15-12-17-7-4-3-5-8-17/h10-11,13-14,17H,3-5,7-8,12,15-16H2,1-2H3,(H,22,24) |
| InChIKey | AIGITTIUNFJXES-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|