C23H36N4O2 — CID 131927649
N-(3-ethylphenyl)-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-4-oxobutanamide (PubChem CID 131927649) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-(3-ethylphenyl)-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-4-oxobutanamide.
| Compound Name | N-(3-ethylphenyl)-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 131927649 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | N-(3-ethylphenyl)-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-4-oxobutanamide |
| SMILES | CCc1cccc(NC(=O)CCC(=O)N2CCCC(CN3CCN(C)CC3)C2)c1 |
| InChI | InChI=1S/C23H36N4O2/c1-3-19-6-4-8-21(16-19)24-22(28)9-10-23(29)27-11-5-7-20(18-27)17-26-14-12-25(2)13-15-26/h4,6,8,16,20H,3,5,7,9-15,17-18H2,1-2H3,(H,24,28) |
| InChIKey | AEIKTHIDPWIARL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |