C23H30N4O2 — CID 131927952
N-[4-[[2-(dimethylamino)acetyl]amino]-3-methylphenyl]-4-piperidin-1-ylbenzamide (PubChem CID 131927952) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-[[2-(dimethylamino)acetyl]amino]-3-methylphenyl]-4-piperidin-1-ylbenzamide.
| Compound Name | N-[4-[[2-(dimethylamino)acetyl]amino]-3-methylphenyl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 131927952 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[4-[[2-(dimethylamino)acetyl]amino]-3-methylphenyl]-4-piperidin-1-ylbenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(N3CCCCC3)cc2)ccc1NC(=O)CN(C)C |
| InChI | InChI=1S/C23H30N4O2/c1-17-15-19(9-12-21(17)25-22(28)16-26(2)3)24-23(29)18-7-10-20(11-8-18)27-13-5-4-6-14-27/h7-12,15H,4-6,13-14,16H2,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | ZACITAQBOZQBAU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |