C21H30N4 — CID 131928719
1-(2,3-dihydro-1H-inden-5-yl)-N-ethyl-N-(2-pyrazol-1-ylethyl)piperidin-4-amine (PubChem CID 131928719) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-N-ethyl-N-(2-pyrazol-1-ylethyl)piperidin-4-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-N-ethyl-N-(2-pyrazol-1-ylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 131928719 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-N-ethyl-N-(2-pyrazol-1-ylethyl)piperidin-4-amine |
| SMILES | CCN(CCn1cccn1)C1CCN(c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C21H30N4/c1-2-23(15-16-25-12-4-11-22-25)20-9-13-24(14-10-20)21-8-7-18-5-3-6-19(18)17-21/h4,7-8,11-12,17,20H,2-3,5-6,9-10,13-16H2,1H3 |
| InChIKey | AXEXXWQLGIBHSU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|