C10H13F3N6 — CID 131931768
3-ethyl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 131931768) has the molecular formula C10H13F3N6 and a molecular weight of 274.25 g/mol. Its IUPAC name is 3-ethyl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 3-ethyl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131931768 |
| Molecular Formula | C10H13F3N6 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-ethyl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | CCc1nc(CCn2cncn2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N6/c1-2-8-16-9(3-4-18-7-14-6-15-18)19(17-8)5-10(11,12)13/h6-7H,2-5H2,1H3 |
| InChIKey | MJTFTQOTZLTORJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |