C19H21NO2S — CID 131933909
3-[5-[[2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 131933909) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-[5-[[2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 131933909 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[5-[[2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | COc1cccc(C2CCCN2Cc2cc(C#CCO)cs2)c1 |
| InChI | InChI=1S/C19H21NO2S/c1-22-17-7-2-6-16(12-17)19-8-3-9-20(19)13-18-11-15(14-23-18)5-4-10-21/h2,6-7,11-12,14,19,21H,3,8-10,13H2,1H3 |
| InChIKey | WWSUBXMXBOMCEP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|