C19H20N2O — CID 41415182
4-[[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]benzonitrile (PubChem CID 41415182) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 41415182 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-[[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]methyl]benzonitrile |
| SMILES | COc1cccc([C@@H]2CCCN2Cc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H20N2O/c1-22-18-5-2-4-17(12-18)19-6-3-11-21(19)14-16-9-7-15(13-20)8-10-16/h2,4-5,7-10,12,19H,3,6,11,14H2,1H3/t19-/m0/s1 |
| InChIKey | LPKNSXFPJKLPFZ-IBGZPJMESA-N |
| XLogP | 3.90 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |