C20H31NO3 — CID 131934224
2-(2-butan-2-ylphenoxy)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylacetamide (PubChem CID 131934224) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylacetamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 131934224 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylacetamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)N(C)CC1(CO)CCCC1 |
| InChI | InChI=1S/C20H31NO3/c1-4-16(2)17-9-5-6-10-18(17)24-13-19(23)21(3)14-20(15-22)11-7-8-12-20/h5-6,9-10,16,22H,4,7-8,11-15H2,1-3H3 |
| InChIKey | RHZVYZLUWMBGBG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |