C27H29N7O4 — CID 131934940
(4S,8S)-6-(3,5,7-trimethyl-1H-indole-2-carbonyl)-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one (PubChem CID 131934940) has the molecular formula C27H29N7O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is (4S,8S)-6-(3,5,7-trimethyl-1H-indole-2-carbonyl)-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one.
| Compound Name | (4S,8S)-6-(3,5,7-trimethyl-1H-indole-2-carbonyl)-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one |
|---|---|
| PubChem CID | 131934940 |
| Molecular Formula | C27H29N7O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (4S,8S)-6-(3,5,7-trimethyl-1H-indole-2-carbonyl)-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)N3C[C@@H]4NC(=O)c5ncccc5OCCn5cc(nn5)CO[C@H]4C3)c(C)c2c1 |
| InChI | InChI=1S/C27H29N7O4/c1-15-9-16(2)23-19(10-15)17(3)24(30-23)27(36)33-12-20-22(13-33)38-14-18-11-34(32-31-18)7-8-37-21-5-4-6-28-25(21)26(35)29-20/h4-6,9-11,20,22,30H,7-8,12-14H2,1-3H3,(H,29,35)/t20-,22-/m0/s1 |
| InChIKey | MFFHJXCJNSLFTE-UNMCSNQZSA-N |
| XLogP | 2.31 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|