C23H28N6O5 — CID 131951352
(4S,8S)-6-[2-(4-oxocyclohexyl)acetyl]-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one (PubChem CID 131951352) has the molecular formula C23H28N6O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is (4S,8S)-6-[2-(4-oxocyclohexyl)acetyl]-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one.
| Compound Name | (4S,8S)-6-[2-(4-oxocyclohexyl)acetyl]-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one |
|---|---|
| PubChem CID | 131951352 |
| Molecular Formula | C23H28N6O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (4S,8S)-6-[2-(4-oxocyclohexyl)acetyl]-3,17-dioxa-6,9,12,20,21,22-hexazatetracyclo[18.2.1.04,8.011,16]tricosa-1(23),11(16),12,14,21-pentaen-10-one |
| SMILES | O=C1CCC(CC(=O)N2C[C@@H]3NC(=O)c4ncccc4OCCn4cc(nn4)CO[C@H]3C2)CC1 |
| InChI | InChI=1S/C23H28N6O5/c30-17-5-3-15(4-6-17)10-21(31)28-12-18-20(13-28)34-14-16-11-29(27-26-16)8-9-33-19-2-1-7-24-22(19)23(32)25-18/h1-2,7,11,15,18,20H,3-6,8-10,12-14H2,(H,25,32)/t18-,20-/m0/s1 |
| InChIKey | UGDVBUKTCSZBHB-ICSRJNTNSA-N |
| XLogP | 0.74 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |