About N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide
N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide (PubChem CID 131934944) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide |
| PubChem CID | 131934944 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide |
| SMILES | Cc1ccc2[nH]c(CCNS(C)(=O)=O)nc2c1C |
| InChI | InChI=1S/C12H17N3O2S/c1-8-4-5-10-12(9(8)2)15-11(14-10)6-7-13-18(3,16)17/h4-5,13H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | PMHZGGGYBMWDGS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide?
The IUPAC name of N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide (CID 131934944) is N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide?
The canonical SMILES for N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide is Cc1ccc2[nH]c(CCNS(C)(=O)=O)nc2c1C.
What is the InChIKey of N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide?
The InChIKey is PMHZGGGYBMWDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-8-4-5-10-12(9(8)2)15-11(14-10)6-7-13-18(3,16)17/h4-5,13H,6-7H2,1-3H3,(H,14,15).
What are the key properties of N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide?
N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide has a molecular weight of 267.35 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethyl]methanesulfonamide is sourced from PubChem (CID 131934944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).