C17H26N2 — CID 54123054
4,5-dimethyl-2-octyl-1H-benzimidazole (PubChem CID 54123054) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 4,5-dimethyl-2-octyl-1H-benzimidazole.
| Compound Name | 4,5-dimethyl-2-octyl-1H-benzimidazole |
|---|---|
| PubChem CID | 54123054 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 4,5-dimethyl-2-octyl-1H-benzimidazole |
| SMILES | CCCCCCCCc1nc2c(C)c(C)ccc2[nH]1 |
| InChI | InChI=1S/C17H26N2/c1-4-5-6-7-8-9-10-16-18-15-12-11-13(2)14(3)17(15)19-16/h11-12H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | NPBGTTVDPLCGOM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|