C14H24N2 — CID 142026179
ethane;2,4,5-trimethyl-1H-benzimidazole (PubChem CID 142026179) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;2,4,5-trimethyl-1H-benzimidazole.
| Compound Name | ethane;2,4,5-trimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 142026179 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;2,4,5-trimethyl-1H-benzimidazole |
| SMILES | CC.CC.Cc1nc2c(C)c(C)ccc2[nH]1 |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-6-4-5-9-10(7(6)2)12-8(3)11-9;2*1-2/h4-5H,1-3H3,(H,11,12);2*1-2H3 |
| InChIKey | KURXXCXXHJGDSU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |