C11H10N4O — CID 137304171
(2Z)-2-(4,5-dimethyl-1H-benzimidazol-2-yl)-2-hydroxyiminoacetonitrile (PubChem CID 137304171) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is (2Z)-2-(4,5-dimethyl-1H-benzimidazol-2-yl)-2-hydroxyiminoacetonitrile.
| Compound Name | (2Z)-2-(4,5-dimethyl-1H-benzimidazol-2-yl)-2-hydroxyiminoacetonitrile |
|---|---|
| PubChem CID | 137304171 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (2Z)-2-(4,5-dimethyl-1H-benzimidazol-2-yl)-2-hydroxyiminoacetonitrile |
| SMILES | Cc1ccc2[nH]c(/C(C#N)=N\O)nc2c1C |
| InChI | InChI=1S/C11H10N4O/c1-6-3-4-8-10(7(6)2)14-11(13-8)9(5-12)15-16/h3-4,16H,1-2H3,(H,13,14)/b15-9- |
| InChIKey | DOADEHGFZULWNV-DHDCSXOGSA-N |
| XLogP | 1.88 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|