C11H12N2 — CID 89393478
2-methyl-3,6,7,8-tetrahydrocyclopenta[e]benzimidazole (PubChem CID 89393478) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-methyl-3,6,7,8-tetrahydrocyclopenta[e]benzimidazole.
| Compound Name | 2-methyl-3,6,7,8-tetrahydrocyclopenta[e]benzimidazole |
|---|---|
| PubChem CID | 89393478 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-methyl-3,6,7,8-tetrahydrocyclopenta[e]benzimidazole |
| SMILES | Cc1nc2c3c(ccc2[nH]1)CCC3 |
| InChI | InChI=1S/C11H12N2/c1-7-12-10-6-5-8-3-2-4-9(8)11(10)13-7/h5-6H,2-4H2,1H3,(H,12,13) |
| InChIKey | MSISSPRXYHYJDU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |