C19H24N6O — CID 72875953
N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]-2-(ethylamino)pyrimidine-5-carboxamide (PubChem CID 72875953) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]-2-(ethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]-2-(ethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72875953 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]-2-(ethylamino)pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCCCc2nc3c(C)c(C)ccc3[nH]2)cn1 |
| InChI | InChI=1S/C19H24N6O/c1-4-20-19-22-10-14(11-23-19)18(26)21-9-5-6-16-24-15-8-7-12(2)13(3)17(15)25-16/h7-8,10-11H,4-6,9H2,1-3H3,(H,21,26)(H,24,25)(H,20,22,23) |
| InChIKey | HVWYZIUFAXAJSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|