C25H18Cl2N2O4 — CID 1319353
1-(3-chloro-4-methylphenyl)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1319353) has the molecular formula C25H18Cl2N2O4 and a molecular weight of 481.34 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1319353 |
| Molecular Formula | C25H18Cl2N2O4 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C(=Cc3cccc(OCc4ccc(Cl)cc4)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C25H18Cl2N2O4/c1-15-5-10-19(13-22(15)27)29-24(31)21(23(30)28-25(29)32)12-17-3-2-4-20(11-17)33-14-16-6-8-18(26)9-7-16/h2-13H,14H2,1H3,(H,28,30,32) |
| InChIKey | XKCRFFQNBGLXFA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|